C19H15FN7+ — CID 123372473
3-[(6-fluoro-1-phenylbenzimidazol-2-yl)methyl]-7H-purin-3-ium-6-amine (PubChem CID 123372473) has the molecular formula C19H15FN7+ and a molecular weight of 360.38 g/mol. Its IUPAC name is 3-[(6-fluoro-1-phenylbenzimidazol-2-yl)methyl]-7H-purin-3-ium-6-amine.
| Compound Name | 3-[(6-fluoro-1-phenylbenzimidazol-2-yl)methyl]-7H-purin-3-ium-6-amine |
|---|---|
| PubChem CID | 123372473 |
| Molecular Formula | C19H15FN7+ |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 3-[(6-fluoro-1-phenylbenzimidazol-2-yl)methyl]-7H-purin-3-ium-6-amine |
| SMILES | Nc1nc[n+](Cc2nc3ccc(F)cc3n2-c2ccccc2)c2nc[nH]c12 |
| InChI | InChI=1S/C19H14FN7/c20-12-6-7-14-15(8-12)27(13-4-2-1-3-5-13)16(25-14)9-26-11-24-18(21)17-19(26)23-10-22-17/h1-8,10-11H,9H2,(H2,21,22,23)/p+1 |
| InChIKey | GDUGAUHNGJTGEO-UHFFFAOYSA-O |
| XLogP | 2.35 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|