C12H26N2 — CID 123373506
3-N-methyl-3-N-(2-methylbutyl)hex-3-ene-1,3-diamine (PubChem CID 123373506) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is 3-N-methyl-3-N-(2-methylbutyl)hex-3-ene-1,3-diamine.
| Compound Name | 3-N-methyl-3-N-(2-methylbutyl)hex-3-ene-1,3-diamine |
|---|---|
| PubChem CID | 123373506 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 3-N-methyl-3-N-(2-methylbutyl)hex-3-ene-1,3-diamine |
| SMILES | CCC=C(CCN)N(C)CC(C)CC |
| InChI | InChI=1S/C12H26N2/c1-5-7-12(8-9-13)14(4)10-11(3)6-2/h7,11H,5-6,8-10,13H2,1-4H3 |
| InChIKey | DRDMFJWLEUCFKA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |