C25H27ClFN5O4Si — CID 123375313
3-amino-6-[4-chloro-3-(5-fluoro-2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]pyrazine-2-carboxylic acid (PubChem CID 123375313) has the molecular formula C25H27ClFN5O4Si and a molecular weight of 544.06 g/mol. Its IUPAC name is 3-amino-6-[4-chloro-3-(5-fluoro-2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]pyrazine-2-carboxylic acid.
| Compound Name | 3-amino-6-[4-chloro-3-(5-fluoro-2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 123375313 |
| Molecular Formula | C25H27ClFN5O4Si |
| Molecular Weight | 544.06 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 3-amino-6-[4-chloro-3-(5-fluoro-2-methoxyphenyl)-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-5-yl]pyrazine-2-carboxylic acid |
| SMILES | COc1ccc(F)cc1-c1cn(COCC[Si](C)(C)C)c2ncc(-c3cnc(N)c(C(=O)O)n3)c(Cl)c12 |
| InChI | InChI=1S/C25H27ClFN5O4Si/c1-35-19-6-5-14(27)9-15(19)17-12-32(13-36-7-8-37(2,3)4)24-20(17)21(26)16(10-30-24)18-11-29-23(28)22(31-18)25(33)34/h5-6,9-12H,7-8,13H2,1-4H3,(H2,28,29)(H,33,34) |
| InChIKey | VBQYIXKJCQXJKR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.06 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|