C24H22F3NO4 — CID 123375715
2,3-difluoro-5-[3-fluoro-5-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]benzoic acid (PubChem CID 123375715) has the molecular formula C24H22F3NO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is 2,3-difluoro-5-[3-fluoro-5-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]benzoic acid.
| Compound Name | 2,3-difluoro-5-[3-fluoro-5-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 123375715 |
| Molecular Formula | C24H22F3NO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 2,3-difluoro-5-[3-fluoro-5-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]phenyl]benzoic acid |
| SMILES | COc1cccc(C(C)NCCOc2cc(F)cc(-c3cc(F)c(F)c(C(=O)O)c3)c2)c1 |
| InChI | InChI=1S/C24H22F3NO4/c1-14(15-4-3-5-19(9-15)31-2)28-6-7-32-20-10-16(8-18(25)13-20)17-11-21(24(29)30)23(27)22(26)12-17/h3-5,8-14,28H,6-7H2,1-2H3,(H,29,30) |
| InChIKey | VRNNOUUSEKPZNN-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|