C27H27F4NO4 — CID 123951870
3-[2-fluoro-5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]phenyl]propanoic acid (PubChem CID 123951870) has the molecular formula C27H27F4NO4 and a molecular weight of 505.51 g/mol. Its IUPAC name is 3-[2-fluoro-5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123951870 |
| Molecular Formula | C27H27F4NO4 |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | 3-[2-fluoro-5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]phenyl]propanoic acid |
| SMILES | COc1cccc(C(C)NCCOc2cc(-c3ccc(F)c(CCC(=O)O)c3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H27F4NO4/c1-17(18-4-3-5-23(14-18)35-2)32-10-11-36-24-15-21(13-22(16-24)27(29,30)31)19-6-8-25(28)20(12-19)7-9-26(33)34/h3-6,8,12-17,32H,7,9-11H2,1-2H3,(H,33,34) |
| InChIKey | AXFLAYIDNLCDLW-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|