C28H30F3NO4 — CID 123854166
3-[5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]-2-methylphenyl]propanoic acid (PubChem CID 123854166) has the molecular formula C28H30F3NO4 and a molecular weight of 501.55 g/mol. Its IUPAC name is 3-[5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]-2-methylphenyl]propanoic acid.
| Compound Name | 3-[5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]-2-methylphenyl]propanoic acid |
|---|---|
| PubChem CID | 123854166 |
| Molecular Formula | C28H30F3NO4 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | 3-[5-[3-[2-[1-(3-methoxyphenyl)ethylamino]ethoxy]-5-(trifluoromethyl)phenyl]-2-methylphenyl]propanoic acid |
| SMILES | COc1cccc(C(C)NCCOc2cc(-c3ccc(C)c(CCC(=O)O)c3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H30F3NO4/c1-18-7-8-22(13-20(18)9-10-27(33)34)23-14-24(28(29,30)31)17-26(16-23)36-12-11-32-19(2)21-5-4-6-25(15-21)35-3/h4-8,13-17,19,32H,9-12H2,1-3H3,(H,33,34) |
| InChIKey | VBHLOHNHZWCNMX-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|