C25H25F2NO4 — CID 144790390
3-[2-fluoro-5-[3-fluoro-5-[2-[(3-methoxyphenyl)methylamino]ethoxy]phenyl]phenyl]propanoic acid (PubChem CID 144790390) has the molecular formula C25H25F2NO4 and a molecular weight of 441.47 g/mol. Its IUPAC name is 3-[2-fluoro-5-[3-fluoro-5-[2-[(3-methoxyphenyl)methylamino]ethoxy]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-5-[3-fluoro-5-[2-[(3-methoxyphenyl)methylamino]ethoxy]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 144790390 |
| Molecular Formula | C25H25F2NO4 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 3-[2-fluoro-5-[3-fluoro-5-[2-[(3-methoxyphenyl)methylamino]ethoxy]phenyl]phenyl]propanoic acid |
| SMILES | COc1cccc(CNCCOc2cc(F)cc(-c3ccc(F)c(CCC(=O)O)c3)c2)c1 |
| InChI | InChI=1S/C25H25F2NO4/c1-31-22-4-2-3-17(11-22)16-28-9-10-32-23-14-20(13-21(26)15-23)18-5-7-24(27)19(12-18)6-8-25(29)30/h2-5,7,11-15,28H,6,8-10,16H2,1H3,(H,29,30) |
| InChIKey | HJIUGYZYSKRUGK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|