C28H28F3NO3 — CID 123860631
N-[2-[3-(2,3-dimethyl-1-benzofuran-5-yl)-5-(trifluoromethyl)phenoxy]ethyl]-1-(3-methoxyphenyl)ethanamine (PubChem CID 123860631) has the molecular formula C28H28F3NO3 and a molecular weight of 483.53 g/mol. Its IUPAC name is N-[2-[3-(2,3-dimethyl-1-benzofuran-5-yl)-5-(trifluoromethyl)phenoxy]ethyl]-1-(3-methoxyphenyl)ethanamine.
| Compound Name | N-[2-[3-(2,3-dimethyl-1-benzofuran-5-yl)-5-(trifluoromethyl)phenoxy]ethyl]-1-(3-methoxyphenyl)ethanamine |
|---|---|
| PubChem CID | 123860631 |
| Molecular Formula | C28H28F3NO3 |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | N-[2-[3-(2,3-dimethyl-1-benzofuran-5-yl)-5-(trifluoromethyl)phenoxy]ethyl]-1-(3-methoxyphenyl)ethanamine |
| SMILES | COc1cccc(C(C)NCCOc2cc(-c3ccc4oc(C)c(C)c4c3)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C28H28F3NO3/c1-17-19(3)35-27-9-8-21(15-26(17)27)22-12-23(28(29,30)31)16-25(14-22)34-11-10-32-18(2)20-6-5-7-24(13-20)33-4/h5-9,12-16,18,32H,10-11H2,1-4H3 |
| InChIKey | LFQUVDIXLIBKMN-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|