C28H26FNO3 — CID 123763594
5-[3-fluoro-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-2-methylbenzoic acid (PubChem CID 123763594) has the molecular formula C28H26FNO3 and a molecular weight of 443.52 g/mol. Its IUPAC name is 5-[3-fluoro-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-2-methylbenzoic acid.
| Compound Name | 5-[3-fluoro-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 123763594 |
| Molecular Formula | C28H26FNO3 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | 5-[3-fluoro-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-2-methylbenzoic acid |
| SMILES | Cc1ccc(-c2cc(F)cc(OCCNC(C)c3cccc4ccccc34)c2)cc1C(=O)O |
| InChI | InChI=1S/C28H26FNO3/c1-18-10-11-21(16-27(18)28(31)32)22-14-23(29)17-24(15-22)33-13-12-30-19(2)25-9-5-7-20-6-3-4-8-26(20)25/h3-11,14-17,19,30H,12-13H2,1-2H3,(H,31,32) |
| InChIKey | VHRXWAKHBLWTKG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|