C30H27F3N2O4 — CID 123302696
3-[3-(methylcarbamoyl)-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-5-(trifluoromethyl)benzoic acid (PubChem CID 123302696) has the molecular formula C30H27F3N2O4 and a molecular weight of 536.55 g/mol. Its IUPAC name is 3-[3-(methylcarbamoyl)-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-5-(trifluoromethyl)benzoic acid.
| Compound Name | 3-[3-(methylcarbamoyl)-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-5-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 123302696 |
| Molecular Formula | C30H27F3N2O4 |
| Molecular Weight | 536.55 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 3-[3-(methylcarbamoyl)-5-[2-(1-naphthalen-1-ylethylamino)ethoxy]phenyl]-5-(trifluoromethyl)benzoic acid |
| SMILES | CNC(=O)c1cc(OCCNC(C)c2cccc3ccccc23)cc(-c2cc(C(=O)O)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H27F3N2O4/c1-18(26-9-5-7-19-6-3-4-8-27(19)26)35-10-11-39-25-16-21(12-22(17-25)28(36)34-2)20-13-23(29(37)38)15-24(14-20)30(31,32)33/h3-9,12-18,35H,10-11H2,1-2H3,(H,34,36)(H,37,38) |
| InChIKey | FQZHDCNDCUBBTB-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|