C28H29N5O2 — CID 123376764
[2-(benzimidazol-1-yl)-4-pyridinyl]-[3-[(2-ethanimidoyl-3-methylphenoxy)methyl]piperidin-1-yl]methanone (PubChem CID 123376764) has the molecular formula C28H29N5O2 and a molecular weight of 467.57 g/mol. Its IUPAC name is [2-(benzimidazol-1-yl)-4-pyridinyl]-[3-[(2-ethanimidoyl-3-methylphenoxy)methyl]piperidin-1-yl]methanone.
| Compound Name | [2-(benzimidazol-1-yl)-4-pyridinyl]-[3-[(2-ethanimidoyl-3-methylphenoxy)methyl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 123376764 |
| Molecular Formula | C28H29N5O2 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | [2-(benzimidazol-1-yl)-4-pyridinyl]-[3-[(2-ethanimidoyl-3-methylphenoxy)methyl]piperidin-1-yl]methanone |
| SMILES | [H]/N=C(\C)c1c(C)cccc1OCC1CCCN(C(=O)c2ccnc(-n3cnc4ccccc43)c2)C1 |
| InChI | InChI=1S/C28H29N5O2/c1-19-7-5-11-25(27(19)20(2)29)35-17-21-8-6-14-32(16-21)28(34)22-12-13-30-26(15-22)33-18-31-23-9-3-4-10-24(23)33/h3-5,7,9-13,15,18,21,29H,6,8,14,16-17H2,1-2H3/b29-20+ |
| InChIKey | DGVPYFQPLMOERS-ZTKZIYFRSA-N |
| XLogP | 5.05 |
| TPSA | 84.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|