C12H21N7O — CID 123379450
3-[2-(aminomethyl)morpholin-4-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 123379450) has the molecular formula C12H21N7O and a molecular weight of 279.35 g/mol. Its IUPAC name is 3-[2-(aminomethyl)morpholin-4-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide.
| Compound Name | 3-[2-(aminomethyl)morpholin-4-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
|---|---|
| PubChem CID | 123379450 |
| Molecular Formula | C12H21N7O |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 3-[2-(aminomethyl)morpholin-4-yl]-3-imino-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | [H]/N=C(\C/C(N)=N/c1cc(C)[nH]n1)N1CCOC(CN)C1 |
| InChI | InChI=1S/C12H21N7O/c1-8-4-12(18-17-8)16-10(14)5-11(15)19-2-3-20-9(6-13)7-19/h4,9,15H,2-3,5-7,13H2,1H3,(H3,14,16,17,18)/b15-11+ |
| InChIKey | RDNCJGJOSGWBRX-RVDMUPIBSA-N |
| XLogP | -0.27 |
| TPSA | 129.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|