C16H25N2+ — CID 123382213
6-benzyl-1,3-dimethyl-5-aza-1-azoniabicyclo[3.2.2]nonane (PubChem CID 123382213) has the molecular formula C16H25N2+ and a molecular weight of 245.39 g/mol. Its IUPAC name is 6-benzyl-1,3-dimethyl-5-aza-1-azoniabicyclo[3.2.2]nonane.
| Compound Name | 6-benzyl-1,3-dimethyl-5-aza-1-azoniabicyclo[3.2.2]nonane |
|---|---|
| PubChem CID | 123382213 |
| Molecular Formula | C16H25N2+ |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.20 |
| IUPAC Name | 6-benzyl-1,3-dimethyl-5-aza-1-azoniabicyclo[3.2.2]nonane |
| SMILES | CC1CN2CC[N+](C)(C1)CC2Cc1ccccc1 |
| InChI | InChI=1S/C16H25N2/c1-14-11-17-8-9-18(2,12-14)13-16(17)10-15-6-4-3-5-7-15/h3-7,14,16H,8-13H2,1-2H3/q+1 |
| InChIKey | HZEIOZXCSCSYDY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|