C19H21ClN5O2+ — CID 123382834
4-chloro-3-methoxy-N-methyl-5-[2-[2-[(1-methyl-2H-azet-1-ium-3-ylidene)amino]pyrimidin-5-yl]ethyl]benzamide (PubChem CID 123382834) has the molecular formula C19H21ClN5O2+ and a molecular weight of 386.86 g/mol. Its IUPAC name is 4-chloro-3-methoxy-N-methyl-5-[2-[2-[(1-methyl-2H-azet-1-ium-3-ylidene)amino]pyrimidin-5-yl]ethyl]benzamide.
| Compound Name | 4-chloro-3-methoxy-N-methyl-5-[2-[2-[(1-methyl-2H-azet-1-ium-3-ylidene)amino]pyrimidin-5-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 123382834 |
| Molecular Formula | C19H21ClN5O2+ |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-chloro-3-methoxy-N-methyl-5-[2-[2-[(1-methyl-2H-azet-1-ium-3-ylidene)amino]pyrimidin-5-yl]ethyl]benzamide |
| SMILES | CNC(=O)c1cc(CCc2cnc(N=C3C=[N+](C)C3)nc2)c(Cl)c(OC)c1 |
| InChI | InChI=1S/C19H20ClN5O2/c1-21-18(26)14-6-13(17(20)16(7-14)27-3)5-4-12-8-22-19(23-9-12)24-15-10-25(2)11-15/h6-10H,4-5,11H2,1-3H3/p+1 |
| InChIKey | KRIRKFKDDKGMSR-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|