C11H15NO — CID 123383619
(4E)-5-methyl-6-(propylideneamino)hepta-1,4,6-trien-3-one (PubChem CID 123383619) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (4E)-5-methyl-6-(propylideneamino)hepta-1,4,6-trien-3-one.
| Compound Name | (4E)-5-methyl-6-(propylideneamino)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 123383619 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (4E)-5-methyl-6-(propylideneamino)hepta-1,4,6-trien-3-one |
| SMILES | C=CC(=O)/C=C(\C)C(=C)/N=C/CC |
| InChI | InChI=1S/C11H15NO/c1-5-7-12-10(4)9(3)8-11(13)6-2/h6-8H,2,4-5H2,1,3H3/b9-8+,12-7+ |
| InChIKey | VAKZWUXQETVUNH-RUQWLHCNSA-N |
| XLogP | 2.68 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|