C20H33N3O8 — CID 123384107
(2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-[3-methyl-3-(2-nitrosoethoxy)butoxy]butyl]amino]-4-oxobutanoate (PubChem CID 123384107) has the molecular formula C20H33N3O8 and a molecular weight of 443.50 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-[3-methyl-3-(2-nitrosoethoxy)butoxy]butyl]amino]-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-[3-methyl-3-(2-nitrosoethoxy)butoxy]butyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123384107 |
| Molecular Formula | C20H33N3O8 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[[3-methyl-3-[3-methyl-3-(2-nitrosoethoxy)butoxy]butyl]amino]-4-oxobutanoate |
| SMILES | CC(C)(CCNC(=O)CCC(=O)On1c(O)ccc1O)OCCC(C)(C)OCCN=O |
| InChI | InChI=1S/C20H33N3O8/c1-19(2,29-13-10-20(3,4)30-14-12-22-28)9-11-21-15(24)5-8-18(27)31-23-16(25)6-7-17(23)26/h6-7,25-26H,5,8-14H2,1-4H3,(H,21,24) |
| InChIKey | FQPJGAKJMXTWIP-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 148.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|