C31H55N3O17 — CID 90746700
(2,5-dihydroxypyrrol-1-yl) 2-[1,3-bis[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propan-2-yloxy]acetate (PubChem CID 90746700) has the molecular formula C31H55N3O17 and a molecular weight of 741.78 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-[1,3-bis[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propan-2-yloxy]acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-[1,3-bis[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propan-2-yloxy]acetate |
|---|---|
| PubChem CID | 90746700 |
| Molecular Formula | C31H55N3O17 |
| Molecular Weight | 741.78 g/mol |
| Exact Mass | 741.35 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-[1,3-bis[2-[2-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]propan-2-yloxy]acetate |
| SMILES | COCCOCCOCC(=O)NCCOCCOCC(COCCOCCNC(=O)COCCOCCOC)OCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C31H55N3O17/c1-40-9-11-44-15-19-48-23-27(35)32-5-7-42-13-17-46-21-26(50-25-31(39)51-34-29(37)3-4-30(34)38)22-47-18-14-43-8-6-33-28(36)24-49-20-16-45-12-10-41-2/h3-4,26,37-38H,5-25H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | IXBIXPNLORTPOR-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 231.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.78 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|