C14H12ClFN4O2 — CID 123386943
ethyl 4-chloro-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 123386943) has the molecular formula C14H12ClFN4O2 and a molecular weight of 322.73 g/mol. Its IUPAC name is ethyl 4-chloro-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 4-chloro-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 123386943 |
| Molecular Formula | C14H12ClFN4O2 |
| Molecular Weight | 322.73 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | ethyl 4-chloro-2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=CNC(c2cnc3ccc(F)cn23)=NC1Cl |
| InChI | InChI=1S/C14H12ClFN4O2/c1-2-22-14(21)9-5-18-13(19-12(9)15)10-6-17-11-4-3-8(16)7-20(10)11/h3-7,12H,2H2,1H3,(H,18,19) |
| InChIKey | SGCIVOVWRPIPCO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.73 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|