C12H17Br2N — CID 123387820
2,6-dibromo-3,8-dimethylcyclodeca-2,6-dien-1-imine (PubChem CID 123387820) has the molecular formula C12H17Br2N and a molecular weight of 335.08 g/mol. Its IUPAC name is 2,6-dibromo-3,8-dimethylcyclodeca-2,6-dien-1-imine.
| Compound Name | 2,6-dibromo-3,8-dimethylcyclodeca-2,6-dien-1-imine |
|---|---|
| PubChem CID | 123387820 |
| Molecular Formula | C12H17Br2N |
| Molecular Weight | 335.08 g/mol |
| Exact Mass | 332.97 |
| IUPAC Name | 2,6-dibromo-3,8-dimethylcyclodeca-2,6-dien-1-imine |
| SMILES | [H]/N=C1/CCC(C)C=C(Br)CCC(C)=C1Br |
| InChI | InChI=1S/C12H17Br2N/c1-8-3-6-11(15)12(14)9(2)4-5-10(13)7-8/h7-8,15H,3-6H2,1-2H3/b10-7?,12-9?,15-11- |
| InChIKey | SRSOINOHBCQCRG-LGYMFGJJSA-N |
| XLogP | 5.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.08 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|