C10H16BrN — CID 123390438
(5Z)-6-bromo-2,5-dimethylocta-2,5-dien-4-imine (PubChem CID 123390438) has the molecular formula C10H16BrN and a molecular weight of 230.15 g/mol. Its IUPAC name is (5Z)-6-bromo-2,5-dimethylocta-2,5-dien-4-imine.
| Compound Name | (5Z)-6-bromo-2,5-dimethylocta-2,5-dien-4-imine |
|---|---|
| PubChem CID | 123390438 |
| Molecular Formula | C10H16BrN |
| Molecular Weight | 230.15 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | (5Z)-6-bromo-2,5-dimethylocta-2,5-dien-4-imine |
| SMILES | [H]/N=C(C=C(C)C)/C(C)=C(\Br)CC |
| InChI | InChI=1S/C10H16BrN/c1-5-9(11)8(4)10(12)6-7(2)3/h6,12H,5H2,1-4H3/b9-8-,12-10+ |
| InChIKey | HSRYAOJOBZHZTK-LVQHWDRTSA-N |
| XLogP | 4.05 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.15 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|