C9H14BrN — CID 123383814
4-bromo-3,6-dimethylhepta-3,6-dien-2-imine (PubChem CID 123383814) has the molecular formula C9H14BrN and a molecular weight of 216.12 g/mol. Its IUPAC name is 4-bromo-3,6-dimethylhepta-3,6-dien-2-imine.
| Compound Name | 4-bromo-3,6-dimethylhepta-3,6-dien-2-imine |
|---|---|
| PubChem CID | 123383814 |
| Molecular Formula | C9H14BrN |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 4-bromo-3,6-dimethylhepta-3,6-dien-2-imine |
| SMILES | [H]/N=C(\C)C(C)=C(Br)CC(=C)C |
| InChI | InChI=1S/C9H14BrN/c1-6(2)5-9(10)7(3)8(4)11/h11H,1,5H2,2-4H3/b9-7?,11-8+ |
| InChIKey | RENIXCPOICKEQT-USAYTYELSA-N |
| XLogP | 3.66 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|