About 4-bromohept-3-en-2-imine
4-bromohept-3-en-2-imine (PubChem CID 91351423) has the molecular formula C7H12BrN
and a molecular weight of 190.08 g/mol. Its IUPAC name is 4-bromohept-3-en-2-imine.
Molecular Properties
| Compound Name | 4-bromohept-3-en-2-imine |
| PubChem CID | 91351423 |
| Molecular Formula | C7H12BrN |
| Molecular Weight | 190.08 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | 4-bromohept-3-en-2-imine |
| SMILES | [H]/N=C(\C)C=C(Br)CCC |
| InChI | InChI=1S/C7H12BrN/c1-3-4-7(8)5-6(2)9/h5,9H,3-4H2,1-2H3/b7-5?,9-6+ |
| InChIKey | QCFZSENCWSRRCC-MHNMJEMNSA-N |
| XLogP | 3.10 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.08 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromohept-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromohept-3-en-2-imine?
The IUPAC name of 4-bromohept-3-en-2-imine (CID 91351423) is 4-bromohept-3-en-2-imine.
What is the SMILES notation for 4-bromohept-3-en-2-imine?
The canonical SMILES for 4-bromohept-3-en-2-imine is [H]/N=C(\C)C=C(Br)CCC.
What is the InChIKey of 4-bromohept-3-en-2-imine?
The InChIKey is QCFZSENCWSRRCC-MHNMJEMNSA-N. The full InChI is InChI=1S/C7H12BrN/c1-3-4-7(8)5-6(2)9/h5,9H,3-4H2,1-2H3/b7-5?,9-6+.
What are the key properties of 4-bromohept-3-en-2-imine?
4-bromohept-3-en-2-imine has a molecular weight of 190.08 g/mol, XLogP of 3.10, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromohept-3-en-2-imine is sourced from PubChem (CID 91351423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).