C8H10BrN — CID 21335501
4-bromo-3,5-dimethylcyclohexa-2,4-dien-1-imine (PubChem CID 21335501) has the molecular formula C8H10BrN and a molecular weight of 200.08 g/mol. Its IUPAC name is 4-bromo-3,5-dimethylcyclohexa-2,4-dien-1-imine.
| Compound Name | 4-bromo-3,5-dimethylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 21335501 |
| Molecular Formula | C8H10BrN |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 4-bromo-3,5-dimethylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C=C(C)C(Br)=C(C)C1 |
| InChI | InChI=1S/C8H10BrN/c1-5-3-7(10)4-6(2)8(5)9/h3,10H,4H2,1-2H3/b10-7- |
| InChIKey | VVUSWOQFCGQNHS-YFHOEESVSA-N |
| XLogP | 3.03 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|