C8H9BrN2 — CID 142951895
3-bromo-6-ethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 142951895) has the molecular formula C8H9BrN2 and a molecular weight of 213.08 g/mol. Its IUPAC name is 3-bromo-6-ethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3-bromo-6-ethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 142951895 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 3-bromo-6-ethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | [H]/N=C1\C(Br)=CC=C(CC)\C1=N/[H] |
| InChI | InChI=1S/C8H9BrN2/c1-2-5-3-4-6(9)8(11)7(5)10/h3-4,10-11H,2H2,1H3/b10-7+,11-8+ |
| InChIKey | LNOKZHWKUZDCHE-AMMQDNIMSA-N |
| XLogP | 2.65 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|