C10H12BrN — CID 142308260
(6E)-6-(1-bromopropylidene)-N-methylcyclohexa-2,4-dien-1-imine (PubChem CID 142308260) has the molecular formula C10H12BrN and a molecular weight of 226.12 g/mol. Its IUPAC name is (6E)-6-(1-bromopropylidene)-N-methylcyclohexa-2,4-dien-1-imine.
| Compound Name | (6E)-6-(1-bromopropylidene)-N-methylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142308260 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (6E)-6-(1-bromopropylidene)-N-methylcyclohexa-2,4-dien-1-imine |
| SMILES | CC/C(Br)=C1/C=CC=C/C1=N\C |
| InChI | InChI=1S/C10H12BrN/c1-3-9(11)8-6-4-5-7-10(8)12-2/h4-7H,3H2,1-2H3/b9-8+,12-10+ |
| InChIKey | TZDVHXIXSQBXGI-CDKJVOIVSA-N |
| XLogP | 3.24 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|