C10H11BrFN — CID 177017589
(6Z)-4-bromo-3-fluoro-N-methyl-6-propylidenecyclohexa-2,4-dien-1-imine (PubChem CID 177017589) has the molecular formula C10H11BrFN and a molecular weight of 244.11 g/mol. Its IUPAC name is (6Z)-4-bromo-3-fluoro-N-methyl-6-propylidenecyclohexa-2,4-dien-1-imine.
| Compound Name | (6Z)-4-bromo-3-fluoro-N-methyl-6-propylidenecyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 177017589 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.11 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | (6Z)-4-bromo-3-fluoro-N-methyl-6-propylidenecyclohexa-2,4-dien-1-imine |
| SMILES | CC/C=C1/C=C(Br)C(F)=C/C1=N\C |
| InChI | InChI=1S/C10H11BrFN/c1-3-4-7-5-8(11)9(12)6-10(7)13-2/h4-6H,3H2,1-2H3/b7-4-,13-10+ |
| InChIKey | PPMWFUJJHIAJAV-ZPSMGGMLSA-N |
| XLogP | 3.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.11 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|