C12H16FN — CID 177041111
(6Z)-6-ethylidene-2-fluoro-N-methyl-4-propylcyclohexa-2,4-dien-1-imine (PubChem CID 177041111) has the molecular formula C12H16FN and a molecular weight of 193.26 g/mol. Its IUPAC name is (6Z)-6-ethylidene-2-fluoro-N-methyl-4-propylcyclohexa-2,4-dien-1-imine.
| Compound Name | (6Z)-6-ethylidene-2-fluoro-N-methyl-4-propylcyclohexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 177041111 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (6Z)-6-ethylidene-2-fluoro-N-methyl-4-propylcyclohexa-2,4-dien-1-imine |
| SMILES | C/C=C1/C=C(CCC)C=C(F)/C1=N\C |
| InChI | InChI=1S/C12H16FN/c1-4-6-9-7-10(5-2)12(14-3)11(13)8-9/h5,7-8H,4,6H2,1-3H3/b10-5-,14-12- |
| InChIKey | GDOWJTCULKBIEV-JKRAQSOCSA-N |
| XLogP | 3.60 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|