About ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine
ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine (PubChem CID 142546380) has the molecular formula C11H16F3N
and a molecular weight of 219.25 g/mol. Its IUPAC name is ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine.
Molecular Properties
| Compound Name | ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine |
| PubChem CID | 142546380 |
| Molecular Formula | C11H16F3N |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine |
| SMILES | C/N=C/C1=CC(C(F)(F)F)=CCC1.CC |
| InChI | InChI=1S/C9H10F3N.C2H6/c1-13-6-7-3-2-4-8(5-7)9(10,11)12;1-2/h4-6H,2-3H2,1H3;1-2H3/b13-6+; |
| InChIKey | BCJVRVGSHWKKRQ-AWFSDRIXSA-N |
| XLogP | 3.92 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine?
The IUPAC name of ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine (CID 142546380) is ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine.
What is the SMILES notation for ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine?
The canonical SMILES for ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine is C/N=C/C1=CC(C(F)(F)F)=CCC1.CC.
What is the InChIKey of ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine?
The InChIKey is BCJVRVGSHWKKRQ-AWFSDRIXSA-N. The full InChI is InChI=1S/C9H10F3N.C2H6/c1-13-6-7-3-2-4-8(5-7)9(10,11)12;1-2/h4-6H,2-3H2,1H3;1-2H3/b13-6+;.
What are the key properties of ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine?
ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine has a molecular weight of 219.25 g/mol, XLogP of 3.92, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-1-[3-(trifluoromethyl)cyclohexa-1,3-dien-1-yl]methanimine is sourced from PubChem (CID 142546380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).