C10H10FN — CID 143372715
1-(4-fluorocyclohepta-1,3,5,6-tetraen-1-yl)-N-methylethanimine (PubChem CID 143372715) has the molecular formula C10H10FN and a molecular weight of 163.19 g/mol. Its IUPAC name is 1-(4-fluorocyclohepta-1,3,5,6-tetraen-1-yl)-N-methylethanimine.
| Compound Name | 1-(4-fluorocyclohepta-1,3,5,6-tetraen-1-yl)-N-methylethanimine |
|---|---|
| PubChem CID | 143372715 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 1-(4-fluorocyclohepta-1,3,5,6-tetraen-1-yl)-N-methylethanimine |
| SMILES | C/N=C(\C)C1=CC=C(F)C=C=C1 |
| InChI | InChI=1S/C10H10FN/c1-8(12-2)9-4-3-5-10(11)7-6-9/h4-7H,1-2H3/b12-8+ |
| InChIKey | MNTICOKABYIQAA-XYOKQWHBSA-N |
| XLogP | 2.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|