C12H17BrFN — CID 123986029
(3Z,7E)-2-bromo-8-fluoro-6-methylideneundeca-3,7-dien-5-imine (PubChem CID 123986029) has the molecular formula C12H17BrFN and a molecular weight of 274.18 g/mol. Its IUPAC name is (3Z,7E)-2-bromo-8-fluoro-6-methylideneundeca-3,7-dien-5-imine.
| Compound Name | (3Z,7E)-2-bromo-8-fluoro-6-methylideneundeca-3,7-dien-5-imine |
|---|---|
| PubChem CID | 123986029 |
| Molecular Formula | C12H17BrFN |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | (3Z,7E)-2-bromo-8-fluoro-6-methylideneundeca-3,7-dien-5-imine |
| SMILES | [H]/N=C(/C=C\C(C)Br)C(=C)/C=C(/F)CCC |
| InChI | InChI=1S/C12H17BrFN/c1-4-5-11(14)8-9(2)12(15)7-6-10(3)13/h6-8,10,15H,2,4-5H2,1,3H3/b7-6-,11-8+,15-12- |
| InChIKey | OTSCQOZFKAYODX-KFJHFCNCSA-N |
| XLogP | 4.56 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|