C11H16FN — CID 174316429
(3Z,5E)-3-(fluoromethyl)-6-methylnona-3,5,8-trien-2-imine (PubChem CID 174316429) has the molecular formula C11H16FN and a molecular weight of 181.25 g/mol. Its IUPAC name is (3Z,5E)-3-(fluoromethyl)-6-methylnona-3,5,8-trien-2-imine.
| Compound Name | (3Z,5E)-3-(fluoromethyl)-6-methylnona-3,5,8-trien-2-imine |
|---|---|
| PubChem CID | 174316429 |
| Molecular Formula | C11H16FN |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.13 |
| IUPAC Name | (3Z,5E)-3-(fluoromethyl)-6-methylnona-3,5,8-trien-2-imine |
| SMILES | [H]/N=C(C)/C(=C/C=C(\C)CC=C)CF |
| InChI | InChI=1S/C11H16FN/c1-4-5-9(2)6-7-11(8-12)10(3)13/h4,6-7,13H,1,5,8H2,2-3H3/b9-6+,11-7+,13-10+ |
| InChIKey | LXAYAGNVVKJLHV-BIAKRINMSA-N |
| XLogP | 3.44 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|