C29H40N6O4 — CID 123388286
tert-butyl N-[2-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]-2-oxoethyl]carbamate (PubChem CID 123388286) has the molecular formula C29H40N6O4 and a molecular weight of 536.68 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 123388286 |
| Molecular Formula | C29H40N6O4 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | tert-butyl N-[2-[2-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]ethylamino]-2-oxoethyl]carbamate |
| SMILES | Cc1cc(-c2noc(-c3nn(C)c4c3CCC(C)(C)C4)n2)cc(C)c1CCNC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H40N6O4/c1-17-13-19(14-18(2)20(17)10-12-30-23(36)16-31-27(37)38-28(3,4)5)25-32-26(39-34-25)24-21-9-11-29(6,7)15-22(21)35(8)33-24/h13-14H,9-12,15-16H2,1-8H3,(H,30,36)(H,31,37) |
| InChIKey | BLCDWMAHNCHQFY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |