C24H32N4O3 — CID 58559290
3-[4-[5-(1-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]propane-1,2-diol (PubChem CID 58559290) has the molecular formula C24H32N4O3 and a molecular weight of 424.55 g/mol. Its IUPAC name is 3-[4-[5-(1-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]propane-1,2-diol.
| Compound Name | 3-[4-[5-(1-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 58559290 |
| Molecular Formula | C24H32N4O3 |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 3-[4-[5-(1-ethyl-6,6-dimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]propane-1,2-diol |
| SMILES | CCn1nc(-c2nc(-c3cc(C)c(CC(O)CO)c(C)c3)no2)c2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C24H32N4O3/c1-6-28-20-12-24(4,5)8-7-18(20)21(26-28)23-25-22(27-31-23)16-9-14(2)19(15(3)10-16)11-17(30)13-29/h9-10,17,29-30H,6-8,11-13H2,1-5H3 |
| InChIKey | CAIGVSKUPRKDEM-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |