C24H30N4O2 — CID 91431191
4-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-one (PubChem CID 91431191) has the molecular formula C24H30N4O2 and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-one.
| Compound Name | 4-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-one |
|---|---|
| PubChem CID | 91431191 |
| Molecular Formula | C24H30N4O2 |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 4-[2,6-dimethyl-4-[5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazol-3-yl]phenyl]butan-2-one |
| SMILES | CC(=O)CCc1c(C)cc(-c2noc(-c3nn(C)c4c3CCC(C)(C)C4)n2)cc1C |
| InChI | InChI=1S/C24H30N4O2/c1-14-11-17(12-15(2)18(14)8-7-16(3)29)22-25-23(30-27-22)21-19-9-10-24(4,5)13-20(19)28(6)26-21/h11-12H,7-10,13H2,1-6H3 |
| InChIKey | LIGKNJCISHVTBY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |