C22H27IN4O — CID 67416932
3-[4-(2-iodoethyl)-3,5-dimethylphenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole (PubChem CID 67416932) has the molecular formula C22H27IN4O and a molecular weight of 490.39 g/mol. Its IUPAC name is 3-[4-(2-iodoethyl)-3,5-dimethylphenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[4-(2-iodoethyl)-3,5-dimethylphenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 67416932 |
| Molecular Formula | C22H27IN4O |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | 3-[4-(2-iodoethyl)-3,5-dimethylphenyl]-5-(1,6,6-trimethyl-5,7-dihydro-4H-indazol-3-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cc(-c2noc(-c3nn(C)c4c3CCC(C)(C)C4)n2)cc(C)c1CCI |
| InChI | InChI=1S/C22H27IN4O/c1-13-10-15(11-14(2)16(13)7-9-23)20-24-21(28-26-20)19-17-6-8-22(3,4)12-18(17)27(5)25-19/h10-11H,6-9,12H2,1-5H3 |
| InChIKey | AAEKZDRIFMQNSX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|