C32H39N5O3 — CID 58559208
ethyl 5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoate (PubChem CID 58559208) has the molecular formula C32H39N5O3 and a molecular weight of 541.70 g/mol. Its IUPAC name is ethyl 5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoate.
| Compound Name | ethyl 5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoate |
|---|---|
| PubChem CID | 58559208 |
| Molecular Formula | C32H39N5O3 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | ethyl 5-[4-[5-[6,6-dimethyl-1-(pyridin-3-ylmethyl)-5,7-dihydro-4H-indazol-3-yl]-1,2,4-oxadiazol-3-yl]-2,6-dimethylphenyl]pentanoate |
| SMILES | CCOC(=O)CCCCc1c(C)cc(-c2noc(-c3nn(Cc4cccnc4)c4c3CCC(C)(C)C4)n2)cc1C |
| InChI | InChI=1S/C32H39N5O3/c1-6-39-28(38)12-8-7-11-25-21(2)16-24(17-22(25)3)30-34-31(40-36-30)29-26-13-14-32(4,5)18-27(26)37(35-29)20-23-10-9-15-33-19-23/h9-10,15-17,19H,6-8,11-14,18,20H2,1-5H3 |
| InChIKey | TUJLJPBSNZQAIY-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 95.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|