C13H14ClN5O — CID 123391803
1-[2-[(2-amino-5-chloropyrimidin-4-yl)amino]anilino]prop-2-en-1-ol (PubChem CID 123391803) has the molecular formula C13H14ClN5O and a molecular weight of 291.74 g/mol. Its IUPAC name is 1-[2-[(2-amino-5-chloropyrimidin-4-yl)amino]anilino]prop-2-en-1-ol.
| Compound Name | 1-[2-[(2-amino-5-chloropyrimidin-4-yl)amino]anilino]prop-2-en-1-ol |
|---|---|
| PubChem CID | 123391803 |
| Molecular Formula | C13H14ClN5O |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 1-[2-[(2-amino-5-chloropyrimidin-4-yl)amino]anilino]prop-2-en-1-ol |
| SMILES | C=CC(O)Nc1ccccc1Nc1nc(N)ncc1Cl |
| InChI | InChI=1S/C13H14ClN5O/c1-2-11(20)17-9-5-3-4-6-10(9)18-12-8(14)7-16-13(15)19-12/h2-7,11,17,20H,1H2,(H3,15,16,18,19) |
| InChIKey | GPEVIRATRNCBMA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 96.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|