C11H18O2 — CID 123392277
4-ethyl-2-methyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine (PubChem CID 123392277) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 4-ethyl-2-methyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine.
| Compound Name | 4-ethyl-2-methyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine |
|---|---|
| PubChem CID | 123392277 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 4-ethyl-2-methyl-4a,5,6,8a-tetrahydro-4H-1,3-benzodioxine |
| SMILES | CCC1OC(C)OC2C=CCCC21 |
| InChI | InChI=1S/C11H18O2/c1-3-10-9-6-4-5-7-11(9)13-8(2)12-10/h5,7-11H,3-4,6H2,1-2H3 |
| InChIKey | ANPPNFKBZQKGSI-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|