C13H22O2 — CID 134980312
(4R,6R)-4,6-dimethyl-2-(3-methylcyclohex-3-en-1-yl)-1,3-dioxane (PubChem CID 134980312) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (4R,6R)-4,6-dimethyl-2-(3-methylcyclohex-3-en-1-yl)-1,3-dioxane.
| Compound Name | (4R,6R)-4,6-dimethyl-2-(3-methylcyclohex-3-en-1-yl)-1,3-dioxane |
|---|---|
| PubChem CID | 134980312 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (4R,6R)-4,6-dimethyl-2-(3-methylcyclohex-3-en-1-yl)-1,3-dioxane |
| SMILES | CC1=CCCC(C2O[C@H](C)C[C@@H](C)O2)C1 |
| InChI | InChI=1S/C13H22O2/c1-9-5-4-6-12(7-9)13-14-10(2)8-11(3)15-13/h5,10-13H,4,6-8H2,1-3H3/t10-,11-,12?/m1/s1 |
| InChIKey | PQGPGHQCNBBUDA-XFKKCKKNSA-N |
| XLogP | 3.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|