C11H16O2 — CID 134937770
2-cyclohex-3-en-1-yl-5-methylidene-1,3-dioxane (PubChem CID 134937770) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-5-methylidene-1,3-dioxane.
| Compound Name | 2-cyclohex-3-en-1-yl-5-methylidene-1,3-dioxane |
|---|---|
| PubChem CID | 134937770 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-5-methylidene-1,3-dioxane |
| SMILES | C=C1COC(C2CC=CCC2)OC1 |
| InChI | InChI=1S/C11H16O2/c1-9-7-12-11(13-8-9)10-5-3-2-4-6-10/h2-3,10-11H,1,4-8H2 |
| InChIKey | XVUQPZYALLHNBV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|