C24H46 — CID 123395690
1,1,2-trimethyl-3-[3-(7-methylundecan-2-yl)cyclobutyl]cyclopentane (PubChem CID 123395690) has the molecular formula C24H46 and a molecular weight of 334.63 g/mol. Its IUPAC name is 1,1,2-trimethyl-3-[3-(7-methylundecan-2-yl)cyclobutyl]cyclopentane.
| Compound Name | 1,1,2-trimethyl-3-[3-(7-methylundecan-2-yl)cyclobutyl]cyclopentane |
|---|---|
| PubChem CID | 123395690 |
| Molecular Formula | C24H46 |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 334.36 |
| IUPAC Name | 1,1,2-trimethyl-3-[3-(7-methylundecan-2-yl)cyclobutyl]cyclopentane |
| SMILES | CCCCC(C)CCCCC(C)C1CC(C2CCC(C)(C)C2C)C1 |
| InChI | InChI=1S/C24H46/c1-7-8-11-18(2)12-9-10-13-19(3)21-16-22(17-21)23-14-15-24(5,6)20(23)4/h18-23H,7-17H2,1-6H3 |
| InChIKey | RTDJPWCDSDDFKX-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|