About 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane
2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane (PubChem CID 91753578) has the molecular formula C32H64
and a molecular weight of 448.86 g/mol. Its IUPAC name is 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane.
Molecular Properties
| Compound Name | 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane |
| PubChem CID | 91753578 |
| Molecular Formula | C32H64 |
| Molecular Weight | 448.86 g/mol |
| Exact Mass | 448.50 |
| IUPAC Name | 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane |
| SMILES | CCCCC(C)CCCC(C)CCCC(C)C1C(C(C)CCCC(C)C)CCC1(C)CC |
| InChI | InChI=1S/C32H64/c1-10-12-17-26(5)18-14-19-27(6)20-15-22-29(8)31-30(23-24-32(31,9)11-2)28(7)21-13-16-25(3)4/h25-31H,10-24H2,1-9H3 |
| InChIKey | ZUAGKGLTGFTOFN-UHFFFAOYSA-N |
| XLogP | 11.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.86 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane?
The IUPAC name of 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane (CID 91753578) is 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane.
What is the SMILES notation for 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane?
The canonical SMILES for 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane is CCCCC(C)CCCC(C)CCCC(C)C1C(C(C)CCCC(C)C)CCC1(C)CC.
What is the InChIKey of 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane?
The InChIKey is ZUAGKGLTGFTOFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H64/c1-10-12-17-26(5)18-14-19-27(6)20-15-22-29(8)31-30(23-24-32(31,9)11-2)28(7)21-13-16-25(3)4/h25-31H,10-24H2,1-9H3.
What are the key properties of 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane?
2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane has a molecular weight of 448.86 g/mol, XLogP of 11.33, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,10-dimethyltetradecan-2-yl)-1-ethyl-1-methyl-3-(6-methylheptan-2-yl)cyclopentane is sourced from PubChem (CID 91753578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).