C32H68P+ — CID 59682355
tributyl(3,7,11,15-tetramethylhexadecyl)phosphanium (PubChem CID 59682355) has the molecular formula C32H68P+ and a molecular weight of 483.87 g/mol. Its IUPAC name is tributyl(3,7,11,15-tetramethylhexadecyl)phosphanium.
| Compound Name | tributyl(3,7,11,15-tetramethylhexadecyl)phosphanium |
|---|---|
| PubChem CID | 59682355 |
| Molecular Formula | C32H68P+ |
| Molecular Weight | 483.87 g/mol |
| Exact Mass | 483.51 |
| IUPAC Name | tributyl(3,7,11,15-tetramethylhexadecyl)phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCC(C)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C32H68P/c1-9-12-25-33(26-13-10-2,27-14-11-3)28-24-32(8)23-17-22-31(7)21-16-20-30(6)19-15-18-29(4)5/h29-32H,9-28H2,1-8H3/q+1 |
| InChIKey | FEEFXSAYDRFCRM-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.87 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|