C24H31ClFN5O2 — CID 123398596
3-[2-chloro-4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]phenoxy]cyclobutan-1-ol (PubChem CID 123398596) has the molecular formula C24H31ClFN5O2 and a molecular weight of 476.00 g/mol. Its IUPAC name is 3-[2-chloro-4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]phenoxy]cyclobutan-1-ol.
| Compound Name | 3-[2-chloro-4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]phenoxy]cyclobutan-1-ol |
|---|---|
| PubChem CID | 123398596 |
| Molecular Formula | C24H31ClFN5O2 |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | 3-[2-chloro-4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]phenoxy]cyclobutan-1-ol |
| SMILES | CC1(C)CCC2CC(Nc3nc(Nc4ccc(OC5CC(O)C5)c(Cl)c4)ncc3F)CCN21 |
| InChI | InChI=1S/C24H31ClFN5O2/c1-24(2)7-5-16-9-15(6-8-31(16)24)28-22-20(26)13-27-23(30-22)29-14-3-4-21(19(25)10-14)33-18-11-17(32)12-18/h3-4,10,13,15-18,32H,5-9,11-12H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | NNRKOTVOYJLNEQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |