C25H34FN5O2 — CID 123822888
3-[4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]-2-methylphenoxy]cyclobutan-1-ol (PubChem CID 123822888) has the molecular formula C25H34FN5O2 and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-[4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]-2-methylphenoxy]cyclobutan-1-ol.
| Compound Name | 3-[4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]-2-methylphenoxy]cyclobutan-1-ol |
|---|---|
| PubChem CID | 123822888 |
| Molecular Formula | C25H34FN5O2 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 3-[4-[[4-[(3,3-dimethyl-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]-5-fluoropyrimidin-2-yl]amino]-2-methylphenoxy]cyclobutan-1-ol |
| SMILES | Cc1cc(Nc2ncc(F)c(NC3CCN4C(CCC4(C)C)C3)n2)ccc1OC1CC(O)C1 |
| InChI | InChI=1S/C25H34FN5O2/c1-15-10-16(4-5-22(15)33-20-12-19(32)13-20)29-24-27-14-21(26)23(30-24)28-17-7-9-31-18(11-17)6-8-25(31,2)3/h4-5,10,14,17-20,32H,6-9,11-13H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | MZKJSMSFVKEPOK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |