C13H15NO4 — CID 123398808
(2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate (PubChem CID 123398808) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate |
|---|---|
| PubChem CID | 123398808 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]hept-5-enyl)acetate |
| SMILES | O=C(CC1CC2C=CC1C2)On1c(O)ccc1O |
| InChI | InChI=1S/C13H15NO4/c15-11-3-4-12(16)14(11)18-13(17)7-10-6-8-1-2-9(10)5-8/h1-4,8-10,15-16H,5-7H2 |
| InChIKey | MFRZBYFAPLOKMG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|