C41H48N2O9 — CID 123401217
2-[4-[7-[4-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]heptoxy]-3-(hydroxymethyl)phenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 123401217) has the molecular formula C41H48N2O9 and a molecular weight of 712.84 g/mol. Its IUPAC name is 2-[4-[7-[4-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]heptoxy]-3-(hydroxymethyl)phenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-[7-[4-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]heptoxy]-3-(hydroxymethyl)phenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 123401217 |
| Molecular Formula | C41H48N2O9 |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.34 |
| IUPAC Name | 2-[4-[7-[4-[2-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]ethenyl]-2,6-dimethoxyphenoxy]heptoxy]-3-(hydroxymethyl)phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(C=Cc2cc(OC)c(OCCCCCCCOc3ccc(C4NC(=O)c5ccccc5N4)cc3CO)c(OC)c2)cc(CO)c1CO |
| InChI | InChI=1S/C41H48N2O9/c1-48-36-20-27(19-30(24-44)33(36)26-46)13-14-28-21-37(49-2)39(38(22-28)50-3)52-18-10-6-4-5-9-17-51-35-16-15-29(23-31(35)25-45)40-42-34-12-8-7-11-32(34)41(47)43-40/h7-8,11-16,19-23,40,42,44-46H,4-6,9-10,17-18,24-26H2,1-3H3,(H,43,47) |
| InChIKey | YZGAJHVIXXKRBA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 147.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|