C41H48N2O8 — CID 89123021
2-[3-methoxy-4-[8-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 89123021) has the molecular formula C41H48N2O8 and a molecular weight of 696.84 g/mol. Its IUPAC name is 2-[3-methoxy-4-[8-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[3-methoxy-4-[8-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 89123021 |
| Molecular Formula | C41H48N2O8 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | 2-[3-methoxy-4-[8-[2-methoxy-5-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]octoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(C2NC(=O)c3ccccc3N2)ccc1OCCCCCCCCOc1cc(/C=C\c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C41H48N2O8/c1-45-33-20-18-28(16-17-29-25-37(47-3)39(49-5)38(26-29)48-4)24-36(33)51-23-13-9-7-6-8-12-22-50-34-21-19-30(27-35(34)46-2)40-42-32-15-11-10-14-31(32)41(44)43-40/h10-11,14-21,24-27,40,42H,6-9,12-13,22-23H2,1-5H3,(H,43,44)/b17-16- |
| InChIKey | WNDDISYKARPDHT-MSUUIHNZSA-N |
| XLogP | 8.55 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|