C37H40N2O9 — CID 67376592
6-methoxy-2-[3-methoxy-4-[3-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 67376592) has the molecular formula C37H40N2O9 and a molecular weight of 656.73 g/mol. Its IUPAC name is 6-methoxy-2-[3-methoxy-4-[3-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 6-methoxy-2-[3-methoxy-4-[3-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 67376592 |
| Molecular Formula | C37H40N2O9 |
| Molecular Weight | 656.73 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | 6-methoxy-2-[3-methoxy-4-[3-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]propoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1ccc2c(c1)C(=O)NC(c1ccc(OCCCOc3cc(/C=C/c4cc(OC)c(OC)c(OC)c4)ccc3OC)c(OC)c1)N2 |
| InChI | InChI=1S/C37H40N2O9/c1-41-26-12-13-28-27(22-26)37(40)39-36(38-28)25-11-15-30(31(21-25)43-3)47-16-7-17-48-32-18-23(10-14-29(32)42-2)8-9-24-19-33(44-4)35(46-6)34(20-24)45-5/h8-15,18-22,36,38H,7,16-17H2,1-6H3,(H,39,40)/b9-8+ |
| InChIKey | OVQOPMJOMXQJDN-CMDGGOBGSA-N |
| XLogP | 6.61 |
| TPSA | 114.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.73 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|