C39H43ClN2O8 — CID 46208321
6-chloro-2-[3-methoxy-4-[6-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 46208321) has the molecular formula C39H43ClN2O8 and a molecular weight of 703.23 g/mol. Its IUPAC name is 6-chloro-2-[3-methoxy-4-[6-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 6-chloro-2-[3-methoxy-4-[6-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 46208321 |
| Molecular Formula | C39H43ClN2O8 |
| Molecular Weight | 703.23 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | 6-chloro-2-[3-methoxy-4-[6-[2-methoxy-5-[(E)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenoxy]hexoxy]phenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | COc1cc(C2NC(=O)c3cc(Cl)ccc3N2)ccc1OCCCCCCOc1cc(/C=C/c2cc(OC)c(OC)c(OC)c2)ccc1OC |
| InChI | InChI=1S/C39H43ClN2O8/c1-44-31-16-12-25(10-11-26-21-35(46-3)37(48-5)36(22-26)47-4)20-34(31)50-19-9-7-6-8-18-49-32-17-13-27(23-33(32)45-2)38-41-30-15-14-28(40)24-29(30)39(43)42-38/h10-17,20-24,38,41H,6-9,18-19H2,1-5H3,(H,42,43)/b11-10+ |
| InChIKey | CDBAMJYKTXAULZ-ZHACJKMWSA-N |
| XLogP | 8.43 |
| TPSA | 105.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.23 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|